C27H36ClF3N2O2 — CID 58588621
4-[4-chloro-3-(trifluoromethyl)phenyl]-1-[[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]methyl]piperidin-4-ol (PubChem CID 58588621) has the molecular formula C27H36ClF3N2O2 and a molecular weight of 513.04 g/mol. Its IUPAC name is 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-[[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]methyl]piperidin-4-ol.
| Compound Name | 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-[[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 58588621 |
| Molecular Formula | C27H36ClF3N2O2 |
| Molecular Weight | 513.04 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-[[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]methyl]piperidin-4-ol |
| SMILES | Cc1c(CN2CCC(O)(c3ccc(Cl)c(C(F)(F)F)c3)CC2)ccc(OCCCCN(C)C)c1C |
| InChI | InChI=1S/C27H36ClF3N2O2/c1-19-20(2)25(35-16-6-5-13-32(3)4)10-7-21(19)18-33-14-11-26(34,12-15-33)22-8-9-24(28)23(17-22)27(29,30)31/h7-10,17,34H,5-6,11-16,18H2,1-4H3 |
| InChIKey | UYZMTSUEHOTATJ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.04 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|