C26H34ClF3N2O2 — CID 58589195
4-[4-chloro-3-(trifluoromethyl)phenyl]-1-[[2,3-dimethyl-4-[4-(methylamino)butoxy]phenyl]methyl]piperidin-4-ol (PubChem CID 58589195) has the molecular formula C26H34ClF3N2O2 and a molecular weight of 499.02 g/mol. Its IUPAC name is 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-[[2,3-dimethyl-4-[4-(methylamino)butoxy]phenyl]methyl]piperidin-4-ol.
| Compound Name | 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-[[2,3-dimethyl-4-[4-(methylamino)butoxy]phenyl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 58589195 |
| Molecular Formula | C26H34ClF3N2O2 |
| Molecular Weight | 499.02 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-[[2,3-dimethyl-4-[4-(methylamino)butoxy]phenyl]methyl]piperidin-4-ol |
| SMILES | CNCCCCOc1ccc(CN2CCC(O)(c3ccc(Cl)c(C(F)(F)F)c3)CC2)c(C)c1C |
| InChI | InChI=1S/C26H34ClF3N2O2/c1-18-19(2)24(34-15-5-4-12-31-3)9-6-20(18)17-32-13-10-25(33,11-14-32)21-7-8-23(27)22(16-21)26(28,29)30/h6-9,16,31,33H,4-5,10-15,17H2,1-3H3 |
| InChIKey | IPJKGRBRLBTSHZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.02 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|