C29H39F3N4O2 — CID 58589040
[(6R,9aS)-6-[2,3-dimethyl-4-[3-(propan-2-ylamino)propoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 58589040) has the molecular formula C29H39F3N4O2 and a molecular weight of 532.65 g/mol. Its IUPAC name is [(6R,9aS)-6-[2,3-dimethyl-4-[3-(propan-2-ylamino)propoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | [(6R,9aS)-6-[2,3-dimethyl-4-[3-(propan-2-ylamino)propoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 58589040 |
| Molecular Formula | C29H39F3N4O2 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | [(6R,9aS)-6-[2,3-dimethyl-4-[3-(propan-2-ylamino)propoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | Cc1c(OCCCNC(C)C)ccc([C@H]2CCC[C@H]3CN(C(=O)c4ccc(C(F)(F)F)nc4)CCN32)c1C |
| InChI | InChI=1S/C29H39F3N4O2/c1-19(2)33-13-6-16-38-26-11-10-24(20(3)21(26)4)25-8-5-7-23-18-35(14-15-36(23)25)28(37)22-9-12-27(34-17-22)29(30,31)32/h9-12,17,19,23,25,33H,5-8,13-16,18H2,1-4H3/t23-,25+/m0/s1 |
| InChIKey | KEBGLFKNWYAPFK-UKILVPOCSA-N |
| XLogP | 5.54 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|