C19H20ClNO4 — CID 58589523
(4S,4aR)-11-chloro-6,9-dimethoxy-3-methyl-1,2,4,4a,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 58589523) has the molecular formula C19H20ClNO4 and a molecular weight of 361.83 g/mol. Its IUPAC name is (4S,4aR)-11-chloro-6,9-dimethoxy-3-methyl-1,2,4,4a,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4S,4aR)-11-chloro-6,9-dimethoxy-3-methyl-1,2,4,4a,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 58589523 |
| Molecular Formula | C19H20ClNO4 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (4S,4aR)-11-chloro-6,9-dimethoxy-3-methyl-1,2,4,4a,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | COC1=C[C@H]2[C@@H]3Cc4c(Cl)cc(OC)c5c4C2(CCN3C)C(O5)C1=O |
| InChI | InChI=1S/C19H20ClNO4/c1-21-5-4-19-10-7-13(23-2)16(22)18(19)25-17-14(24-3)8-11(20)9(15(17)19)6-12(10)21/h7-8,10,12,18H,4-6H2,1-3H3/t10-,12-,18?,19?/m0/s1 |
| InChIKey | MTHUYAHRKNMHPO-QNGPPCBZSA-N |
| XLogP | 2.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |