C20H22ClNO3 — CID 10067045
(4aR,7S,7aR)-11-chloro-9-methoxy-3-prop-2-enyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol (PubChem CID 10067045) has the molecular formula C20H22ClNO3 and a molecular weight of 359.85 g/mol. Its IUPAC name is (4aR,7S,7aR)-11-chloro-9-methoxy-3-prop-2-enyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol.
| Compound Name | (4aR,7S,7aR)-11-chloro-9-methoxy-3-prop-2-enyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
|---|---|
| PubChem CID | 10067045 |
| Molecular Formula | C20H22ClNO3 |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (4aR,7S,7aR)-11-chloro-9-methoxy-3-prop-2-enyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
| SMILES | C=CCN1CCC23c4c5c(Cl)cc(OC)c4O[C@H]2[C@@H](O)C=C[C@H]3C1C5 |
| InChI | InChI=1S/C20H22ClNO3/c1-3-7-22-8-6-20-12-4-5-15(23)19(20)25-18-16(24-2)10-13(21)11(17(18)20)9-14(12)22/h3-5,10,12,14-15,19,23H,1,6-9H2,2H3/t12-,14?,15-,19-,20?/m0/s1 |
| InChIKey | LGZWLTHZQWRNKN-USBKIIESSA-N |
| XLogP | 2.71 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|