C20H21NO3 — CID 135199896
(3S,4R,7S,8R,16S)-11-methoxy-2-prop-2-enyl-9-oxa-2-azahexacyclo[12.3.1.01,3.04,16.08,16.010,15]octadeca-5,10,12,14-tetraen-7-ol (PubChem CID 135199896) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (3S,4R,7S,8R,16S)-11-methoxy-2-prop-2-enyl-9-oxa-2-azahexacyclo[12.3.1.01,3.04,16.08,16.010,15]octadeca-5,10,12,14-tetraen-7-ol.
| Compound Name | (3S,4R,7S,8R,16S)-11-methoxy-2-prop-2-enyl-9-oxa-2-azahexacyclo[12.3.1.01,3.04,16.08,16.010,15]octadeca-5,10,12,14-tetraen-7-ol |
|---|---|
| PubChem CID | 135199896 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (3S,4R,7S,8R,16S)-11-methoxy-2-prop-2-enyl-9-oxa-2-azahexacyclo[12.3.1.01,3.04,16.08,16.010,15]octadeca-5,10,12,14-tetraen-7-ol |
| SMILES | C=CCN1[C@H]2[C@@H]3C=C[C@H](O)[C@@H]4Oc5c(OC)ccc6c5[C@]34CC21C6 |
| InChI | InChI=1S/C20H21NO3/c1-3-8-21-17-12-5-6-13(22)18-20(12)10-19(17,21)9-11-4-7-14(23-2)16(24-18)15(11)20/h3-7,12-13,17-18,22H,1,8-10H2,2H3/t12-,13-,17-,18-,19?,20-,21?/m0/s1 |
| InChIKey | SZBIAPOIVWHDRK-SNAMHQEHSA-N |
| XLogP | 1.81 |
| TPSA | 41.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|