C30H36ClN3O5 — CID 58591974
(2S)-1-[[1-[4-(2-chloro-4-methylphenoxy)phenyl]-2-methylpropan-2-yl]amino]-3-[2-(cyclopropylmethylamino)-3-nitrophenoxy]propan-2-ol (PubChem CID 58591974) has the molecular formula C30H36ClN3O5 and a molecular weight of 554.09 g/mol. Its IUPAC name is (2S)-1-[[1-[4-(2-chloro-4-methylphenoxy)phenyl]-2-methylpropan-2-yl]amino]-3-[2-(cyclopropylmethylamino)-3-nitrophenoxy]propan-2-ol.
| Compound Name | (2S)-1-[[1-[4-(2-chloro-4-methylphenoxy)phenyl]-2-methylpropan-2-yl]amino]-3-[2-(cyclopropylmethylamino)-3-nitrophenoxy]propan-2-ol |
|---|---|
| PubChem CID | 58591974 |
| Molecular Formula | C30H36ClN3O5 |
| Molecular Weight | 554.09 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | (2S)-1-[[1-[4-(2-chloro-4-methylphenoxy)phenyl]-2-methylpropan-2-yl]amino]-3-[2-(cyclopropylmethylamino)-3-nitrophenoxy]propan-2-ol |
| SMILES | Cc1ccc(Oc2ccc(CC(C)(C)NC[C@H](O)COc3cccc([N+](=O)[O-])c3NCC3CC3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C30H36ClN3O5/c1-20-7-14-27(25(31)15-20)39-24-12-10-21(11-13-24)16-30(2,3)33-18-23(35)19-38-28-6-4-5-26(34(36)37)29(28)32-17-22-8-9-22/h4-7,10-15,22-23,32-33,35H,8-9,16-19H2,1-3H3/t23-/m0/s1 |
| InChIKey | SDBFPSMNLVQUAU-QHCPKHFHSA-N |
| XLogP | 6.52 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.09 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|