C28H32N6O2 — CID 58592700
2-[[4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-6-nitroaniline (PubChem CID 58592700) has the molecular formula C28H32N6O2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-[[4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-6-nitroaniline.
| Compound Name | 2-[[4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-6-nitroaniline |
|---|---|
| PubChem CID | 58592700 |
| Molecular Formula | C28H32N6O2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 2-[[4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-6-nitroaniline |
| SMILES | CC(C)(C)c1ccc(-c2nc3c(N4CCN(Cc5cccc([N+](=O)[O-])c5N)CC4)cccc3[nH]2)cc1 |
| InChI | InChI=1S/C28H32N6O2/c1-28(2,3)21-12-10-19(11-13-21)27-30-22-7-5-9-24(26(22)31-27)33-16-14-32(15-17-33)18-20-6-4-8-23(25(20)29)34(35)36/h4-13H,14-18,29H2,1-3H3,(H,30,31) |
| InChIKey | FFNMNYGHYVLLJQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|