C11H14F3NO — CID 58592703
5-propan-2-yl-1-(3,3,3-trifluoropropyl)pyridin-2-one (PubChem CID 58592703) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is 5-propan-2-yl-1-(3,3,3-trifluoropropyl)pyridin-2-one.
| Compound Name | 5-propan-2-yl-1-(3,3,3-trifluoropropyl)pyridin-2-one |
|---|---|
| PubChem CID | 58592703 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 5-propan-2-yl-1-(3,3,3-trifluoropropyl)pyridin-2-one |
| SMILES | CC(C)c1ccc(=O)n(CCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F3NO/c1-8(2)9-3-4-10(16)15(7-9)6-5-11(12,13)14/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | YJEHJXZKEXFOSZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |