C16H28F3N3O2 — CID 58593029
tert-butyl 4-[[3-(trifluoromethyl)pyrrolidin-3-yl]methylamino]piperidine-1-carboxylate (PubChem CID 58593029) has the molecular formula C16H28F3N3O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is tert-butyl 4-[[3-(trifluoromethyl)pyrrolidin-3-yl]methylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-(trifluoromethyl)pyrrolidin-3-yl]methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58593029 |
| Molecular Formula | C16H28F3N3O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | tert-butyl 4-[[3-(trifluoromethyl)pyrrolidin-3-yl]methylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NCC2(C(F)(F)F)CCNC2)CC1 |
| InChI | InChI=1S/C16H28F3N3O2/c1-14(2,3)24-13(23)22-8-4-12(5-9-22)21-11-15(16(17,18)19)6-7-20-10-15/h12,20-21H,4-11H2,1-3H3 |
| InChIKey | GSWCZXYZUOSBKE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |