C34H52O13S2 — CID 58595039
[3-[(2S,4S,5R)-6-ethyl-3,4,5-trihydroxy-2,3,4,5,6-pentamethyloxan-2-yl]oxy-2-[(2S)-2-methoxy-1-(4-methylphenyl)sulfonyloxypropan-2-yl]oxy-2-methylpropyl] 4-methylbenzenesulfonate (PubChem CID 58595039) has the molecular formula C34H52O13S2 and a molecular weight of 732.91 g/mol. Its IUPAC name is [3-[(2S,4S,5R)-6-ethyl-3,4,5-trihydroxy-2,3,4,5,6-pentamethyloxan-2-yl]oxy-2-[(2S)-2-methoxy-1-(4-methylphenyl)sulfonyloxypropan-2-yl]oxy-2-methylpropyl] 4-methylbenzenesulfonate.
| Compound Name | [3-[(2S,4S,5R)-6-ethyl-3,4,5-trihydroxy-2,3,4,5,6-pentamethyloxan-2-yl]oxy-2-[(2S)-2-methoxy-1-(4-methylphenyl)sulfonyloxypropan-2-yl]oxy-2-methylpropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58595039 |
| Molecular Formula | C34H52O13S2 |
| Molecular Weight | 732.91 g/mol |
| Exact Mass | 732.28 |
| IUPAC Name | [3-[(2S,4S,5R)-6-ethyl-3,4,5-trihydroxy-2,3,4,5,6-pentamethyloxan-2-yl]oxy-2-[(2S)-2-methoxy-1-(4-methylphenyl)sulfonyloxypropan-2-yl]oxy-2-methylpropyl] 4-methylbenzenesulfonate |
| SMILES | CCC1(C)O[C@](C)(OCC(C)(COS(=O)(=O)c2ccc(C)cc2)O[C@@](C)(COS(=O)(=O)c2ccc(C)cc2)OC)C(C)(O)[C@@](C)(O)[C@@]1(C)O |
| InChI | InChI=1S/C34H52O13S2/c1-12-29(5)31(7,35)32(8,36)33(9,37)34(10,47-29)43-21-28(4,22-44-48(38,39)26-17-13-24(2)14-18-26)46-30(6,42-11)23-45-49(40,41)27-19-15-25(3)16-20-27/h13-20,35-37H,12,21-23H2,1-11H3/t28?,29?,30-,31-,32-,33?,34-/m0/s1 |
| InChIKey | WMIDCUITAIXSGD-KJEKJFONSA-N |
| XLogP | 3.74 |
| TPSA | 184.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.91 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|