C8H13NO3 — CID 58595355
1-[(2R,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]ethanone (PubChem CID 58595355) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 1-[(2R,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]ethanone.
| Compound Name | 1-[(2R,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 58595355 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 1-[(2R,4R)-1-acetyl-4-hydroxypyrrolidin-2-yl]ethanone |
| SMILES | CC(=O)[C@H]1C[C@@H](O)CN1C(C)=O |
| InChI | InChI=1S/C8H13NO3/c1-5(10)8-3-7(12)4-9(8)6(2)11/h7-8,12H,3-4H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | XWLIPOSNYPQJOP-HTQZYQBOSA-N |
| XLogP | -0.44 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |