C16H31NO6Si — CID 66822605
1-[(2S)-1-acetyl-4-hydroxypyrrolidin-2-yl]-4-triethoxysilylbutan-1-one (PubChem CID 66822605) has the molecular formula C16H31NO6Si and a molecular weight of 361.51 g/mol. Its IUPAC name is 1-[(2S)-1-acetyl-4-hydroxypyrrolidin-2-yl]-4-triethoxysilylbutan-1-one.
| Compound Name | 1-[(2S)-1-acetyl-4-hydroxypyrrolidin-2-yl]-4-triethoxysilylbutan-1-one |
|---|---|
| PubChem CID | 66822605 |
| Molecular Formula | C16H31NO6Si |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 1-[(2S)-1-acetyl-4-hydroxypyrrolidin-2-yl]-4-triethoxysilylbutan-1-one |
| SMILES | CCO[Si](CCCC(=O)[C@@H]1CC(O)CN1C(C)=O)(OCC)OCC |
| InChI | InChI=1S/C16H31NO6Si/c1-5-21-24(22-6-2,23-7-3)10-8-9-16(20)15-11-14(19)12-17(15)13(4)18/h14-15,19H,5-12H2,1-4H3/t14?,15-/m0/s1 |
| InChIKey | FCXJKUAMUAVQIA-LOACHALJSA-N |
| XLogP | 1.37 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|