C24H48Cl2MnN5S2-5 — CID 58595851
2-[(1R,4S,12R,15R)-12-(tert-butylsulfanylmethyl)-2,5,8,11,14-pentazanidabicyclo[13.4.0]nonadecan-4-yl]ethyl-trimethyl-λ4-sulfane;dichloromanganese (PubChem CID 58595851) has the molecular formula C24H48Cl2MnN5S2-5 and a molecular weight of 596.66 g/mol. Its IUPAC name is 2-[(1R,4S,12R,15R)-12-(tert-butylsulfanylmethyl)-2,5,8,11,14-pentazanidabicyclo[13.4.0]nonadecan-4-yl]ethyl-trimethyl-λ4-sulfane;dichloromanganese.
| Compound Name | 2-[(1R,4S,12R,15R)-12-(tert-butylsulfanylmethyl)-2,5,8,11,14-pentazanidabicyclo[13.4.0]nonadecan-4-yl]ethyl-trimethyl-λ4-sulfane;dichloromanganese |
|---|---|
| PubChem CID | 58595851 |
| Molecular Formula | C24H48Cl2MnN5S2-5 |
| Molecular Weight | 596.66 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | 2-[(1R,4S,12R,15R)-12-(tert-butylsulfanylmethyl)-2,5,8,11,14-pentazanidabicyclo[13.4.0]nonadecan-4-yl]ethyl-trimethyl-λ4-sulfane;dichloromanganese |
| SMILES | CC(C)(C)SC[C@H]1C[N-][C@@H]2CCCC[C@H]2[N-]C[C@H](CCS(C)(C)C)[N-]CC[N-]CC[N-]1.Cl[Mn]Cl |
| InChI | InChI=1S/C24H48N5S2.2ClH.Mn/c1-24(2,3)30-19-21-18-29-23-10-8-7-9-22(23)28-17-20(11-16-31(4,5)6)26-14-12-25-13-15-27-21;;;/h20-23H,7-19H2,1-6H3;2*1H;/q-5;;;+2/p-2/t20-,21+,22+,23+;;;/m0.../s1 |
| InChIKey | QDJBOPBSHDXDKU-HTLGNOQQSA-L |
| XLogP | 7.91 |
| TPSA | 70.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.66 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |