C19H37Cl2MnN6-5 — CID 58595898
dichloromanganese;3-[(1R,4S,7R,10S,15R)-7,10-dimethyl-2,5,8,11,14-pentazanidabicyclo[13.4.0]nonadecan-4-yl]propan-1-amine (PubChem CID 58595898) has the molecular formula C19H37Cl2MnN6-5 and a molecular weight of 475.39 g/mol. Its IUPAC name is dichloromanganese;3-[(1R,4S,7R,10S,15R)-7,10-dimethyl-2,5,8,11,14-pentazanidabicyclo[13.4.0]nonadecan-4-yl]propan-1-amine.
| Compound Name | dichloromanganese;3-[(1R,4S,7R,10S,15R)-7,10-dimethyl-2,5,8,11,14-pentazanidabicyclo[13.4.0]nonadecan-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 58595898 |
| Molecular Formula | C19H37Cl2MnN6-5 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | dichloromanganese;3-[(1R,4S,7R,10S,15R)-7,10-dimethyl-2,5,8,11,14-pentazanidabicyclo[13.4.0]nonadecan-4-yl]propan-1-amine |
| SMILES | C[C@@H]1C[N-][C@@H](CCCN)C[N-][C@@H]2CCCC[C@H]2[N-]CC[N-][C@@H](C)C[N-]1.Cl[Mn]Cl |
| InChI | InChI=1S/C19H37N6.2ClH.Mn/c1-15-12-23-16(2)13-24-17(6-5-9-20)14-25-19-8-4-3-7-18(19)22-11-10-21-15;;;/h15-19H,3-14,20H2,1-2H3;2*1H;/q-5;;;+2/p-2/t15-,16+,17-,18+,19+;;;/m0.../s1 |
| InChIKey | GAURNMFBSVIKFM-ZLQHFKLVSA-L |
| XLogP | 5.44 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |