C18H32MgN2 — CID 11033935
magnesium bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ide) (PubChem CID 11033935) has the molecular formula C18H32MgN2 and a molecular weight of 300.77 g/mol. Its IUPAC name is magnesium bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ide).
| Compound Name | magnesium bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ide) |
|---|---|
| PubChem CID | 11033935 |
| Molecular Formula | C18H32MgN2 |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.24 |
| IUPAC Name | magnesium bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ide) |
| SMILES | C1CCC2[N-]CCCC2C1.C1CCC2[N-]CCCC2C1.[Mg+2] |
| InChI | InChI=1S/2C9H16N.Mg/c2*1-2-6-9-8(4-1)5-3-7-10-9;/h2*8-9H,1-7H2;/q2*-1;+2 |
| InChIKey | NNHAYBCDWPOKSE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |