C9H15CsNO- — CID 59061592
cesium 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-8-olate (PubChem CID 59061592) has the molecular formula C9H15CsNO- and a molecular weight of 286.13 g/mol. Its IUPAC name is cesium 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-8-olate.
| Compound Name | cesium 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-8-olate |
|---|---|
| PubChem CID | 59061592 |
| Molecular Formula | C9H15CsNO- |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | cesium 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-8-olate |
| SMILES | [Cs+].[O-]C1CCCC2CCC[N-]C12 |
| InChI | InChI=1S/C9H15NO.Cs/c11-8-5-1-3-7-4-2-6-10-9(7)8;/h7-9H,1-6H2;/q-2;+1 |
| InChIKey | OPVGDMMDCFXEMO-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 37.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |