C18H30MgN2O2-2 — CID 156595532
magnesium bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-8-olate) (PubChem CID 156595532) has the molecular formula C18H30MgN2O2-2 and a molecular weight of 330.76 g/mol. Its IUPAC name is magnesium bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-8-olate).
| Compound Name | magnesium bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-8-olate) |
|---|---|
| PubChem CID | 156595532 |
| Molecular Formula | C18H30MgN2O2-2 |
| Molecular Weight | 330.76 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | magnesium bis(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-8-olate) |
| SMILES | [Mg+2].[O-]C1CCCC2CCC[N-]C12.[O-]C1CCCC2CCC[N-]C12 |
| InChI | InChI=1S/2C9H15NO.Mg/c2*11-8-5-1-3-7-4-2-6-10-9(7)8;/h2*7-9H,1-6H2;/q2*-2;+2 |
| InChIKey | YZJRXYCJAJTDOD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 74.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.76 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |