C11H21NU — CID 59783806
3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-ide;2-methylpropane;uranium(2+) (PubChem CID 59783806) has the molecular formula C11H21NU and a molecular weight of 405.33 g/mol. Its IUPAC name is 3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-ide;2-methylpropane;uranium(2+).
| Compound Name | 3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-ide;2-methylpropane;uranium(2+) |
|---|---|
| PubChem CID | 59783806 |
| Molecular Formula | C11H21NU |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-ide;2-methylpropane;uranium(2+) |
| SMILES | C1CC2CC[N-]C2C1.C[C-](C)C.[U+2] |
| InChI | InChI=1S/C7H12N.C4H9.U/c1-2-6-4-5-8-7(6)3-1;1-4(2)3;/h6-7H,1-5H2;1-3H3;/q2*-1;+2 |
| InChIKey | DFPVDIWKBPAFKR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|