C7H13N2W- — CID 155621611
2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-c]pyridin-1-ide;tungsten (PubChem CID 155621611) has the molecular formula C7H13N2W- and a molecular weight of 309.04 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-c]pyridin-1-ide;tungsten.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-c]pyridin-1-ide;tungsten |
|---|---|
| PubChem CID | 155621611 |
| Molecular Formula | C7H13N2W- |
| Molecular Weight | 309.04 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-c]pyridin-1-ide;tungsten |
| SMILES | C1CC2CNCCC2[N-]1.[W] |
| InChI | InChI=1S/C7H13N2.W/c1-4-9-7-2-3-8-5-6(1)7;/h6-8H,1-5H2;/q-1; |
| InChIKey | YSBGNXHAXYGTFR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 26.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.04 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |