C14H28N2U — CID 59783764
5-tert-butyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-ide;2-methylpropane;uranium(2+) (PubChem CID 59783764) has the molecular formula C14H28N2U and a molecular weight of 462.42 g/mol. Its IUPAC name is 5-tert-butyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-ide;2-methylpropane;uranium(2+).
| Compound Name | 5-tert-butyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-ide;2-methylpropane;uranium(2+) |
|---|---|
| PubChem CID | 59783764 |
| Molecular Formula | C14H28N2U |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 5-tert-butyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-ide;2-methylpropane;uranium(2+) |
| SMILES | CC(C)(C)N1CC2CC[N-]C2C1.C[C-](C)C.[U+2] |
| InChI | InChI=1S/C10H19N2.C4H9.U/c1-10(2,3)12-6-8-4-5-11-9(8)7-12;1-4(2)3;/h8-9H,4-7H2,1-3H3;1-3H3;/q2*-1;+2 |
| InChIKey | UQBRPHJVSBPAQZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|