C9H17KN2 — CID 171744429
potassium 5-propan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-ide (PubChem CID 171744429) has the molecular formula C9H17KN2 and a molecular weight of 192.35 g/mol. Its IUPAC name is potassium 5-propan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-ide.
| Compound Name | potassium 5-propan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-ide |
|---|---|
| PubChem CID | 171744429 |
| Molecular Formula | C9H17KN2 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | potassium 5-propan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-ide |
| SMILES | CC(C)N1CC2CC[N-]C2C1.[K+] |
| InChI | InChI=1S/C9H17N2.K/c1-7(2)11-5-8-3-4-10-9(8)6-11;/h7-9H,3-6H2,1-2H3;/q-1;+1 |
| InChIKey | RSGGHOVMCRQAHN-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |