C14H24Br2MnN2O-2 — CID 4866679
dibromomanganese;2-(3,6-dihydro-2H-pyridin-1-id-6-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ide;hydrate (PubChem CID 4866679) has the molecular formula C14H24Br2MnN2O-2 and a molecular weight of 451.11 g/mol. Its IUPAC name is dibromomanganese;2-(3,6-dihydro-2H-pyridin-1-id-6-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ide;hydrate.
| Compound Name | dibromomanganese;2-(3,6-dihydro-2H-pyridin-1-id-6-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ide;hydrate |
|---|---|
| PubChem CID | 4866679 |
| Molecular Formula | C14H24Br2MnN2O-2 |
| Molecular Weight | 451.11 g/mol |
| Exact Mass | 448.96 |
| IUPAC Name | dibromomanganese;2-(3,6-dihydro-2H-pyridin-1-id-6-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ide;hydrate |
| SMILES | Br[Mn]Br.C1=CC(C2CCC3CCCCC3[N-]2)[N-]CC1.O |
| InChI | InChI=1S/C14H22N2.2BrH.Mn.H2O/c1-2-6-12-11(5-1)8-9-14(16-12)13-7-3-4-10-15-13;;;;/h3,7,11-14H,1-2,4-6,8-10H2;2*1H;;1H2/q-2;;;+2;/p-2 |
| InChIKey | BAMNRWFHBXZINV-UHFFFAOYSA-L |
| XLogP | 4.65 |
| TPSA | 59.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.11 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|