C14H22N4O4S — CID 58596086
2-ethoxy-N'-hydroxy-5-(4-methylpiperazin-1-yl)sulfonylbenzenecarboximidamide (PubChem CID 58596086) has the molecular formula C14H22N4O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-ethoxy-N'-hydroxy-5-(4-methylpiperazin-1-yl)sulfonylbenzenecarboximidamide.
| Compound Name | 2-ethoxy-N'-hydroxy-5-(4-methylpiperazin-1-yl)sulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 58596086 |
| Molecular Formula | C14H22N4O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2-ethoxy-N'-hydroxy-5-(4-methylpiperazin-1-yl)sulfonylbenzenecarboximidamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(C)CC2)cc1/C(N)=N/O |
| InChI | InChI=1S/C14H22N4O4S/c1-3-22-13-5-4-11(10-12(13)14(15)16-19)23(20,21)18-8-6-17(2)7-9-18/h4-5,10,19H,3,6-9H2,1-2H3,(H2,15,16) |
| InChIKey | KSNPHOBSUQWVQR-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|