C15H25N5O3S — CID 87274597
N'-amino-2-ethoxy-5-(4-ethylpiperazin-1-yl)sulfonylbenzenecarboximidamide (PubChem CID 87274597) has the molecular formula C15H25N5O3S and a molecular weight of 355.46 g/mol. Its IUPAC name is N'-amino-2-ethoxy-5-(4-ethylpiperazin-1-yl)sulfonylbenzenecarboximidamide.
| Compound Name | N'-amino-2-ethoxy-5-(4-ethylpiperazin-1-yl)sulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 87274597 |
| Molecular Formula | C15H25N5O3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | N'-amino-2-ethoxy-5-(4-ethylpiperazin-1-yl)sulfonylbenzenecarboximidamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(CC)CC2)cc1/C(N)=N/N |
| InChI | InChI=1S/C15H25N5O3S/c1-3-19-7-9-20(10-8-19)24(21,22)12-5-6-14(23-4-2)13(11-12)15(16)18-17/h5-6,11H,3-4,7-10,17H2,1-2H3,(H2,16,18) |
| InChIKey | MCVRYDPFBONXRR-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|