C25H23ClN4O — CID 58599490
1-[4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]phenyl]-5-pyrrol-1-ylpentan-1-one (PubChem CID 58599490) has the molecular formula C25H23ClN4O and a molecular weight of 430.94 g/mol. Its IUPAC name is 1-[4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]phenyl]-5-pyrrol-1-ylpentan-1-one.
| Compound Name | 1-[4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]phenyl]-5-pyrrol-1-ylpentan-1-one |
|---|---|
| PubChem CID | 58599490 |
| Molecular Formula | C25H23ClN4O |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 1-[4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]phenyl]-5-pyrrol-1-ylpentan-1-one |
| SMILES | O=C(CCCCn1cccc1)c1ccc(Nc2nccc(-c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C25H23ClN4O/c26-21-10-6-19(7-11-21)23-14-15-27-25(29-23)28-22-12-8-20(9-13-22)24(31)5-1-2-16-30-17-3-4-18-30/h3-4,6-15,17-18H,1-2,5,16H2,(H,27,28,29) |
| InChIKey | STCANHVUXKJOBN-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|