C23H17F3N4O2S — CID 58601096
N-[2-formyl-4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 58601096) has the molecular formula C23H17F3N4O2S and a molecular weight of 470.48 g/mol. Its IUPAC name is N-[2-formyl-4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-formyl-4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58601096 |
| Molecular Formula | C23H17F3N4O2S |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | N-[2-formyl-4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=Cc1cc(CCNc2ncnc3ccsc23)ccc1NC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H17F3N4O2S/c24-23(25,26)17-3-1-2-15(11-17)22(32)30-18-5-4-14(10-16(18)12-31)6-8-27-21-20-19(7-9-33-20)28-13-29-21/h1-5,7,9-13H,6,8H2,(H,30,32)(H,27,28,29) |
| InChIKey | TZABLYCJPUMZGQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|