C14H20FN — CID 58601309
(3R,4S)-3-(4-fluorophenyl)-4-methyl-1-propan-2-ylpyrrolidine (PubChem CID 58601309) has the molecular formula C14H20FN and a molecular weight of 221.32 g/mol. Its IUPAC name is (3R,4S)-3-(4-fluorophenyl)-4-methyl-1-propan-2-ylpyrrolidine.
| Compound Name | (3R,4S)-3-(4-fluorophenyl)-4-methyl-1-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 58601309 |
| Molecular Formula | C14H20FN |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | (3R,4S)-3-(4-fluorophenyl)-4-methyl-1-propan-2-ylpyrrolidine |
| SMILES | CC(C)N1C[C@@H](C)[C@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C14H20FN/c1-10(2)16-8-11(3)14(9-16)12-4-6-13(15)7-5-12/h4-7,10-11,14H,8-9H2,1-3H3/t11-,14-/m1/s1 |
| InChIKey | GKMWZLGIJKCGOP-BXUZGUMPSA-N |
| XLogP | 3.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |