C31H32Cl2N6O4S — CID 58601660
methyl N-carbamoyl-N'-[3-[[2-(3,4-dichlorophenyl)acetyl]-[2-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]amino]propyl]carbamimidothioate (PubChem CID 58601660) has the molecular formula C31H32Cl2N6O4S and a molecular weight of 655.61 g/mol. Its IUPAC name is methyl N-carbamoyl-N'-[3-[[2-(3,4-dichlorophenyl)acetyl]-[2-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]amino]propyl]carbamimidothioate.
| Compound Name | methyl N-carbamoyl-N'-[3-[[2-(3,4-dichlorophenyl)acetyl]-[2-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]amino]propyl]carbamimidothioate |
|---|---|
| PubChem CID | 58601660 |
| Molecular Formula | C31H32Cl2N6O4S |
| Molecular Weight | 655.61 g/mol |
| Exact Mass | 654.16 |
| IUPAC Name | methyl N-carbamoyl-N'-[3-[[2-(3,4-dichlorophenyl)acetyl]-[2-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]amino]propyl]carbamimidothioate |
| SMILES | COc1ccc(-n2c(CCN(CCC/N=C(/NC(N)=O)SC)C(=O)Cc3ccc(Cl)c(Cl)c3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C31H32Cl2N6O4S/c1-43-22-11-9-21(10-12-22)39-27(36-26-7-4-3-6-23(26)29(39)41)14-17-38(16-5-15-35-31(44-2)37-30(34)42)28(40)19-20-8-13-24(32)25(33)18-20/h3-4,6-13,18H,5,14-17,19H2,1-2H3,(H3,34,35,37,42) |
| InChIKey | PKQALDCXZYFTTP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.61 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|