C4H8Cl3O4PS — CID 58602247
hydroxy-methoxy-sulfanylidene-(2,2,2-trichloro-1-methoxyethoxy)-λ5-phosphane (PubChem CID 58602247) has the molecular formula C4H8Cl3O4PS and a molecular weight of 289.50 g/mol. Its IUPAC name is hydroxy-methoxy-sulfanylidene-(2,2,2-trichloro-1-methoxyethoxy)-λ5-phosphane.
| Compound Name | hydroxy-methoxy-sulfanylidene-(2,2,2-trichloro-1-methoxyethoxy)-λ5-phosphane |
|---|---|
| PubChem CID | 58602247 |
| Molecular Formula | C4H8Cl3O4PS |
| Molecular Weight | 289.50 g/mol |
| Exact Mass | 287.89 |
| IUPAC Name | hydroxy-methoxy-sulfanylidene-(2,2,2-trichloro-1-methoxyethoxy)-λ5-phosphane |
| SMILES | COC(OP(O)(=S)OC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H8Cl3O4PS/c1-9-3(4(5,6)7)11-12(8,13)10-2/h3H,1-2H3,(H,8,13) |
| InChIKey | UUISGDZLRQIKJY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|