C7H16BO4PS — CID 88555900
CID 88555900 (PubChem CID 88555900) has the molecular formula C7H16BO4PS and a molecular weight of 238.05 g/mol.
| Compound Name | CID 88555900 |
|---|---|
| PubChem CID | 88555900 |
| Molecular Formula | C7H16BO4PS |
| Molecular Weight | 238.05 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | — |
| SMILES | [B]CO[C@H](CC)C(C)OP(O)(=S)OC |
| InChI | InChI=1S/C7H16BO4PS/c1-4-7(11-5-8)6(2)12-13(9,14)10-3/h6-7H,4-5H2,1-3H3,(H,9,14)/t6?,7-,13?/m1/s1 |
| InChIKey | HZYCKNHUTXDUNS-MWBVSFINSA-N |
| XLogP | 1.18 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.05 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|