C12H24N4 — CID 58603025
2-(4-butylpiperazin-1-yl)-1,4,5,6-tetrahydropyrimidine (PubChem CID 58603025) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-(4-butylpiperazin-1-yl)-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-(4-butylpiperazin-1-yl)-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 58603025 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | 2-(4-butylpiperazin-1-yl)-1,4,5,6-tetrahydropyrimidine |
| SMILES | CCCCN1CCN(C2=NCCCN2)CC1 |
| InChI | InChI=1S/C12H24N4/c1-2-3-7-15-8-10-16(11-9-15)12-13-5-4-6-14-12/h2-11H2,1H3,(H,13,14) |
| InChIKey | ZCPNIZAHPHAIPN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |