C20H36N2O6SSi — CID 58604471
methyl (3R,6S,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 58604471) has the molecular formula C20H36N2O6SSi and a molecular weight of 460.67 g/mol. Its IUPAC name is methyl (3R,6S,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | methyl (3R,6S,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 58604471 |
| Molecular Formula | C20H36N2O6SSi |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | methyl (3R,6S,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CS[C@H]2C[C@@](CO[Si](C)(C)C(C)(C)C)(NC(=O)OC(C)(C)C)C(=O)N21 |
| InChI | InChI=1S/C20H36N2O6SSi/c1-18(2,3)28-17(25)21-20(12-27-30(8,9)19(4,5)6)10-14-22(16(20)24)13(11-29-14)15(23)26-7/h13-14H,10-12H2,1-9H3,(H,21,25)/t13-,14-,20-/m0/s1 |
| InChIKey | TUXMRZFBYUEDMJ-YRVVQQKDSA-N |
| XLogP | 3.12 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|