C30H46N4O6S — CID 58604768
tert-butyl N-[(2S)-1-[(1R,2S)-2-[[(3R)-1,2-dioxo-1-(thiophen-2-ylmethylamino)hexan-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 58604768) has the molecular formula C30H46N4O6S and a molecular weight of 590.79 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(1R,2S)-2-[[(3R)-1,2-dioxo-1-(thiophen-2-ylmethylamino)hexan-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(1R,2S)-2-[[(3R)-1,2-dioxo-1-(thiophen-2-ylmethylamino)hexan-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58604768 |
| Molecular Formula | C30H46N4O6S |
| Molecular Weight | 590.79 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(1R,2S)-2-[[(3R)-1,2-dioxo-1-(thiophen-2-ylmethylamino)hexan-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCC[C@@H](NC(=O)[C@@H]1[C@@H]2C(CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C2(C)C)C(=O)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C30H46N4O6S/c1-10-12-19(22(35)25(37)31-15-17-13-11-14-41-17)32-24(36)21-20-18(30(20,8)9)16-34(21)26(38)23(28(2,3)4)33-27(39)40-29(5,6)7/h11,13-14,18-21,23H,10,12,15-16H2,1-9H3,(H,31,37)(H,32,36)(H,33,39)/t18?,19-,20+,21+,23-/m1/s1 |
| InChIKey | NOTPAWKZXLSROA-CYVPJEJKSA-N |
| XLogP | 3.64 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.79 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|