C30H51N5O7 — CID 58908699
tert-butyl N-[(2S)-1-[(1R,2S,5S)-2-[[1,2-dioxo-1-[[2-oxo-2-(propylamino)ethyl]amino]hexan-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 58908699) has the molecular formula C30H51N5O7 and a molecular weight of 593.77 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(1R,2S,5S)-2-[[1,2-dioxo-1-[[2-oxo-2-(propylamino)ethyl]amino]hexan-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(1R,2S,5S)-2-[[1,2-dioxo-1-[[2-oxo-2-(propylamino)ethyl]amino]hexan-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58908699 |
| Molecular Formula | C30H51N5O7 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.38 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(1R,2S,5S)-2-[[1,2-dioxo-1-[[2-oxo-2-(propylamino)ethyl]amino]hexan-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCNC(=O)CNC(=O)C(=O)C(CCC)NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C30H51N5O7/c1-11-13-18(22(37)25(39)32-15-19(36)31-14-12-2)33-24(38)21-20-17(30(20,9)10)16-35(21)26(40)23(28(3,4)5)34-27(41)42-29(6,7)8/h17-18,20-21,23H,11-16H2,1-10H3,(H,31,36)(H,32,39)(H,33,38)(H,34,41)/t17-,18?,20-,21-,23+/m0/s1 |
| InChIKey | IXWIOUVNLNKZGL-SUVRBXJUSA-N |
| XLogP | 1.91 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|