C34H50N4O6 — CID 58604824
[(1R,7S)-7-tricyclo[3.3.1.01,3]nonanyl] N-[(1S)-2-[(2S)-2-[(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate (PubChem CID 58604824) has the molecular formula C34H50N4O6 and a molecular weight of 610.80 g/mol. Its IUPAC name is [(1R,7S)-7-tricyclo[3.3.1.01,3]nonanyl] N-[(1S)-2-[(2S)-2-[(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate.
| Compound Name | [(1R,7S)-7-tricyclo[3.3.1.01,3]nonanyl] N-[(1S)-2-[(2S)-2-[(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 58604824 |
| Molecular Formula | C34H50N4O6 |
| Molecular Weight | 610.80 g/mol |
| Exact Mass | 610.37 |
| IUPAC Name | [(1R,7S)-7-tricyclo[3.3.1.01,3]nonanyl] N-[(1S)-2-[(2S)-2-[(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
| SMILES | CC1(C)C2CN(C(=O)[C@@H](NC(=O)O[C@H]3CC4CC5C[C@@]5(C4)C3)C3CCCCC3)[C@H](C(=O)NC(CC3CCC3)C(=O)C(N)=O)C21 |
| InChI | InChI=1S/C34H50N4O6/c1-33(2)23-17-38(27(25(23)33)30(41)36-24(28(39)29(35)40)13-18-7-6-8-18)31(42)26(20-9-4-3-5-10-20)37-32(43)44-22-12-19-11-21-15-34(21,14-19)16-22/h18-27H,3-17H2,1-2H3,(H2,35,40)(H,36,41)(H,37,43)/t19?,21?,22-,23?,24?,25?,26-,27-,34-/m0/s1 |
| InChIKey | LAOLSJIYZGGFRM-UZOBLZDISA-N |
| XLogP | 3.45 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.80 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|