C30H46N4O6 — CID 58751269
[(1S,2S)-2-methylcyclopentyl] N-[(1S)-2-[(1R,2S)-2-[(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate (PubChem CID 58751269) has the molecular formula C30H46N4O6 and a molecular weight of 558.72 g/mol. Its IUPAC name is [(1S,2S)-2-methylcyclopentyl] N-[(1S)-2-[(1R,2S)-2-[(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate.
| Compound Name | [(1S,2S)-2-methylcyclopentyl] N-[(1S)-2-[(1R,2S)-2-[(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 58751269 |
| Molecular Formula | C30H46N4O6 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | [(1S,2S)-2-methylcyclopentyl] N-[(1S)-2-[(1R,2S)-2-[(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
| SMILES | C[C@H]1CCC[C@@H]1OC(=O)N[C@H](C(=O)N1CC2[C@@H]([C@H]1C(=O)NC(CC1CC1)C(=O)C(N)=O)C2(C)C)C1CCCCC1 |
| InChI | InChI=1S/C30H46N4O6/c1-16-8-7-11-21(16)40-29(39)33-23(18-9-5-4-6-10-18)28(38)34-15-19-22(30(19,2)3)24(34)27(37)32-20(14-17-12-13-17)25(35)26(31)36/h16-24H,4-15H2,1-3H3,(H2,31,36)(H,32,37)(H,33,39)/t16-,19?,20?,21-,22-,23-,24-/m0/s1 |
| InChIKey | CZFUMSLGESWRQX-RZNGVRESSA-N |
| XLogP | 2.67 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|