C29H40N4O6 — CID 58604966
propan-2-yl N-[(1S)-2-[(1R,2S,5S)-2-[(1-amino-1,2-dioxohexan-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-(2,3-dihydro-1H-inden-2-yl)-2-oxoethyl]carbamate (PubChem CID 58604966) has the molecular formula C29H40N4O6 and a molecular weight of 540.66 g/mol. Its IUPAC name is propan-2-yl N-[(1S)-2-[(1R,2S,5S)-2-[(1-amino-1,2-dioxohexan-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-(2,3-dihydro-1H-inden-2-yl)-2-oxoethyl]carbamate.
| Compound Name | propan-2-yl N-[(1S)-2-[(1R,2S,5S)-2-[(1-amino-1,2-dioxohexan-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-(2,3-dihydro-1H-inden-2-yl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 58604966 |
| Molecular Formula | C29H40N4O6 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | propan-2-yl N-[(1S)-2-[(1R,2S,5S)-2-[(1-amino-1,2-dioxohexan-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-(2,3-dihydro-1H-inden-2-yl)-2-oxoethyl]carbamate |
| SMILES | CCCC(NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)C)C1Cc3ccccc3C1)C2(C)C)C(=O)C(N)=O |
| InChI | InChI=1S/C29H40N4O6/c1-6-9-20(24(34)25(30)35)31-26(36)23-21-19(29(21,4)5)14-33(23)27(37)22(32-28(38)39-15(2)3)18-12-16-10-7-8-11-17(16)13-18/h7-8,10-11,15,18-23H,6,9,12-14H2,1-5H3,(H2,30,35)(H,31,36)(H,32,38)/t19-,20?,21-,22-,23-/m0/s1 |
| InChIKey | VBRLJXHJZXUSIF-KLYMBLKMSA-N |
| XLogP | 1.73 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|