C31H44N4O6 — CID 58606208
tert-butyl N-[(1S)-1-(2,3-dihydro-1H-inden-2-yl)-2-[(1R,2S,5S)-6,6-dimethyl-2-[[1-(methylamino)-1,2-dioxohexan-3-yl]carbamoyl]-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]carbamate (PubChem CID 58606208) has the molecular formula C31H44N4O6 and a molecular weight of 568.72 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(2,3-dihydro-1H-inden-2-yl)-2-[(1R,2S,5S)-6,6-dimethyl-2-[[1-(methylamino)-1,2-dioxohexan-3-yl]carbamoyl]-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(2,3-dihydro-1H-inden-2-yl)-2-[(1R,2S,5S)-6,6-dimethyl-2-[[1-(methylamino)-1,2-dioxohexan-3-yl]carbamoyl]-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 58606208 |
| Molecular Formula | C31H44N4O6 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | tert-butyl N-[(1S)-1-(2,3-dihydro-1H-inden-2-yl)-2-[(1R,2S,5S)-6,6-dimethyl-2-[[1-(methylamino)-1,2-dioxohexan-3-yl]carbamoyl]-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]carbamate |
| SMILES | CCCC(NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C1Cc3ccccc3C1)C2(C)C)C(=O)C(=O)NC |
| InChI | InChI=1S/C31H44N4O6/c1-8-11-21(25(36)27(38)32-7)33-26(37)24-22-20(31(22,5)6)16-35(24)28(39)23(34-29(40)41-30(2,3)4)19-14-17-12-9-10-13-18(17)15-19/h9-10,12-13,19-24H,8,11,14-16H2,1-7H3,(H,32,38)(H,33,37)(H,34,40)/t20-,21?,22-,23-,24-/m0/s1 |
| InChIKey | FLQZXJNLULZHDA-ONZABHSXSA-N |
| XLogP | 2.38 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|