C17H24N2O3S — CID 58608886
N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-6-[(2-sulfanylacetyl)amino]hexanamide (PubChem CID 58608886) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-6-[(2-sulfanylacetyl)amino]hexanamide.
| Compound Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-6-[(2-sulfanylacetyl)amino]hexanamide |
|---|---|
| PubChem CID | 58608886 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-6-[(2-sulfanylacetyl)amino]hexanamide |
| SMILES | O=C(CS)NCCCCCC(=O)NCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C17H24N2O3S/c20-16(4-2-1-3-8-18-17(21)12-23)19-11-13-5-6-15-14(10-13)7-9-22-15/h5-6,10,23H,1-4,7-9,11-12H2,(H,18,21)(H,19,20) |
| InChIKey | CPBDSVCFFDLICJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|