C22H35N3O2 — CID 123217543
N-[5-(2,3-dihydro-1-benzofuran-5-ylmethylamino)pentyl]-3-piperidin-1-ylpropanamide (PubChem CID 123217543) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is N-[5-(2,3-dihydro-1-benzofuran-5-ylmethylamino)pentyl]-3-piperidin-1-ylpropanamide.
| Compound Name | N-[5-(2,3-dihydro-1-benzofuran-5-ylmethylamino)pentyl]-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 123217543 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | N-[5-(2,3-dihydro-1-benzofuran-5-ylmethylamino)pentyl]-3-piperidin-1-ylpropanamide |
| SMILES | O=C(CCN1CCCCC1)NCCCCCNCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C22H35N3O2/c26-22(9-15-25-13-5-2-6-14-25)24-12-4-1-3-11-23-18-19-7-8-21-20(17-19)10-16-27-21/h7-8,17,23H,1-6,9-16,18H2,(H,24,26) |
| InChIKey | NWITXPPLZFQENT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|