C14H17NO — CID 103701656
N-(2,3-dihydro-1-benzofuran-5-ylmethyl)pent-4-yn-1-amine (PubChem CID 103701656) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-5-ylmethyl)pent-4-yn-1-amine.
| Compound Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)pent-4-yn-1-amine |
|---|---|
| PubChem CID | 103701656 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)pent-4-yn-1-amine |
| SMILES | C#CCCCNCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C14H17NO/c1-2-3-4-8-15-11-12-5-6-14-13(10-12)7-9-16-14/h1,5-6,10,15H,3-4,7-9,11H2 |
| InChIKey | LWONAILOVLPYPZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|