C32H34F3N3O2 — CID 58610277
3-(hydroxymethyl)-N-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 58610277) has the molecular formula C32H34F3N3O2 and a molecular weight of 549.64 g/mol. Its IUPAC name is 3-(hydroxymethyl)-N-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-(hydroxymethyl)-N-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 58610277 |
| Molecular Formula | C32H34F3N3O2 |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | 3-(hydroxymethyl)-N-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(NCCCCN1CCC(c2c[nH]c3ccccc23)CC1)c1ccc(-c2ccc(C(F)(F)F)cc2)c(CO)c1 |
| InChI | InChI=1S/C32H34F3N3O2/c33-32(34,35)26-10-7-22(8-11-26)27-12-9-24(19-25(27)21-39)31(40)36-15-3-4-16-38-17-13-23(14-18-38)29-20-37-30-6-2-1-5-28(29)30/h1-2,5-12,19-20,23,37,39H,3-4,13-18,21H2,(H,36,40) |
| InChIKey | JXXJHKLYWGRFQU-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|