C12H20NO2Y- — CID 58610530
(3R,7aS)-3-tert-butyl-7a-ethyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-id-1-one;yttrium (PubChem CID 58610530) has the molecular formula C12H20NO2Y- and a molecular weight of 299.20 g/mol. Its IUPAC name is (3R,7aS)-3-tert-butyl-7a-ethyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-id-1-one;yttrium.
| Compound Name | (3R,7aS)-3-tert-butyl-7a-ethyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-id-1-one;yttrium |
|---|---|
| PubChem CID | 58610530 |
| Molecular Formula | C12H20NO2Y- |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (3R,7aS)-3-tert-butyl-7a-ethyl-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-id-1-one;yttrium |
| SMILES | CC[C@@]12C[CH-]CN1[C@@H](C(C)(C)C)OC2=O.[Y] |
| InChI | InChI=1S/C12H20NO2.Y/c1-5-12-7-6-8-13(12)9(11(2,3)4)15-10(12)14;/h6,9H,5,7-8H2,1-4H3;/q-1;/t9-,12+;/m1./s1 |
| InChIKey | IPEGMRPYXGITES-KATIXKQHSA-N |
| XLogP | 1.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|