C32H22N6O8S2 — CID 58611282
2-[[(E)-(4-cyano-1-oxo-3-phenylpyrido[1,2-a]benzimidazol-2-ylidene)methyl]amino]-4-methoxy-5-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]benzenesulfonic acid (PubChem CID 58611282) has the molecular formula C32H22N6O8S2 and a molecular weight of 682.70 g/mol. Its IUPAC name is 2-[[(E)-(4-cyano-1-oxo-3-phenylpyrido[1,2-a]benzimidazol-2-ylidene)methyl]amino]-4-methoxy-5-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[(E)-(4-cyano-1-oxo-3-phenylpyrido[1,2-a]benzimidazol-2-ylidene)methyl]amino]-4-methoxy-5-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 58611282 |
| Molecular Formula | C32H22N6O8S2 |
| Molecular Weight | 682.70 g/mol |
| Exact Mass | 682.09 |
| IUPAC Name | 2-[[(E)-(4-cyano-1-oxo-3-phenylpyrido[1,2-a]benzimidazol-2-ylidene)methyl]amino]-4-methoxy-5-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]benzenesulfonic acid |
| SMILES | COc1cc(N/C=c2\c(-c3ccccc3)c(C#N)c3nc4ccccc4n3c2=O)c(S(=O)(=O)O)cc1/N=N/c1ccc(SOOO)cc1 |
| InChI | InChI=1S/C32H22N6O8S2/c1-44-28-15-26(29(48(41,42)43)16-25(28)37-36-20-11-13-21(14-12-20)47-46-45-40)34-18-23-30(19-7-3-2-4-8-19)22(17-33)31-35-24-9-5-6-10-27(24)38(31)32(23)39/h2-16,18,34,40H,1H3,(H,41,42,43)/b23-18+,37-36+ |
| InChIKey | ODGKKPIFJYIREG-ZDADJSKPSA-N |
| XLogP | 6.05 |
| TPSA | 197.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.70 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|