C26H19N7O8S2 — CID 136608079
2-[(4-cyano-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazol-2-yl)diazenyl]-4-methoxy-5-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]benzenesulfonic acid (PubChem CID 136608079) has the molecular formula C26H19N7O8S2 and a molecular weight of 621.61 g/mol. Its IUPAC name is 2-[(4-cyano-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazol-2-yl)diazenyl]-4-methoxy-5-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-[(4-cyano-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazol-2-yl)diazenyl]-4-methoxy-5-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136608079 |
| Molecular Formula | C26H19N7O8S2 |
| Molecular Weight | 621.61 g/mol |
| Exact Mass | 621.07 |
| IUPAC Name | 2-[(4-cyano-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazol-2-yl)diazenyl]-4-methoxy-5-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]benzenesulfonic acid |
| SMILES | COc1cc(/N=N/c2c(C)c(C#N)c3[nH]c4ccccc4n3c2=O)c(S(=O)(=O)O)cc1/N=N/c1ccc(SOOO)cc1 |
| InChI | InChI=1S/C26H19N7O8S2/c1-14-17(13-27)25-28-18-5-3-4-6-21(18)33(25)26(34)24(14)32-31-20-11-22(39-2)19(12-23(20)43(36,37)38)30-29-15-7-9-16(10-8-15)42-41-40-35/h3-12,28,35H,1-2H3,(H,36,37,38)/b30-29+,32-31+ |
| InChIKey | XMJYGBMCDKDXCP-PNBBGTCESA-N |
| XLogP | 6.48 |
| TPSA | 212.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.61 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|