C15H10N8O — CID 171978285
3-methyl-1-oxo-2-(1H-1,2,4-triazol-5-yldiazenyl)-5H-pyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 171978285) has the molecular formula C15H10N8O and a molecular weight of 318.30 g/mol. Its IUPAC name is 3-methyl-1-oxo-2-(1H-1,2,4-triazol-5-yldiazenyl)-5H-pyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 3-methyl-1-oxo-2-(1H-1,2,4-triazol-5-yldiazenyl)-5H-pyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 171978285 |
| Molecular Formula | C15H10N8O |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 3-methyl-1-oxo-2-(1H-1,2,4-triazol-5-yldiazenyl)-5H-pyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | Cc1c(/N=N/c2ncn[nH]2)c(=O)n2c([nH]c3ccccc32)c1C#N |
| InChI | InChI=1S/C15H10N8O/c1-8-9(6-16)13-19-10-4-2-3-5-11(10)23(13)14(24)12(8)20-22-15-17-7-18-21-15/h2-5,7,19H,1H3,(H,17,18,21)/b22-20+ |
| InChIKey | OGVNNTRQONXHIO-LSDHQDQOSA-N |
| XLogP | 2.49 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|