C29H19N5O7S2 — CID 136508586
4-(benzenesulfonyloxy)-5-[(4-cyano-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazol-2-yl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136508586) has the molecular formula C29H19N5O7S2 and a molecular weight of 613.63 g/mol. Its IUPAC name is 4-(benzenesulfonyloxy)-5-[(4-cyano-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazol-2-yl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 4-(benzenesulfonyloxy)-5-[(4-cyano-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazol-2-yl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136508586 |
| Molecular Formula | C29H19N5O7S2 |
| Molecular Weight | 613.63 g/mol |
| Exact Mass | 613.07 |
| IUPAC Name | 4-(benzenesulfonyloxy)-5-[(4-cyano-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazol-2-yl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Cc1c(/N=N/c2cccc3cc(S(=O)(=O)O)cc(OS(=O)(=O)c4ccccc4)c23)c(=O)n2c([nH]c3ccccc32)c1C#N |
| InChI | InChI=1S/C29H19N5O7S2/c1-17-21(16-30)28-31-22-11-5-6-13-24(22)34(28)29(35)27(17)33-32-23-12-7-8-18-14-20(42(36,37)38)15-25(26(18)23)41-43(39,40)19-9-3-2-4-10-19/h2-15,31H,1H3,(H,36,37,38)/b33-32+ |
| InChIKey | RRBZPVLRPGSBLS-ULIFNZDWSA-N |
| XLogP | 5.54 |
| TPSA | 183.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.63 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|