C21H14N4O3 — CID 135453667
2-[(4-cyano-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazol-2-yl)methylideneamino]benzoic acid (PubChem CID 135453667) has the molecular formula C21H14N4O3 and a molecular weight of 370.37 g/mol. Its IUPAC name is 2-[(4-cyano-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazol-2-yl)methylideneamino]benzoic acid.
| Compound Name | 2-[(4-cyano-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazol-2-yl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 135453667 |
| Molecular Formula | C21H14N4O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[(4-cyano-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazol-2-yl)methylideneamino]benzoic acid |
| SMILES | Cc1c(/C=N/c2ccccc2C(=O)O)c(=O)n2c([nH]c3ccccc32)c1C#N |
| InChI | InChI=1S/C21H14N4O3/c1-12-14(10-22)19-24-17-8-4-5-9-18(17)25(19)20(26)15(12)11-23-16-7-3-2-6-13(16)21(27)28/h2-9,11,24H,1H3,(H,27,28)/b23-11+ |
| InChIKey | OZMKRQFXEUKZKS-FOKLQQMPSA-N |
| XLogP | 3.41 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|