C20H13BrN4O — CID 135479225
2-[(2-bromophenyl)iminomethyl]-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 135479225) has the molecular formula C20H13BrN4O and a molecular weight of 405.26 g/mol. Its IUPAC name is 2-[(2-bromophenyl)iminomethyl]-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 2-[(2-bromophenyl)iminomethyl]-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 135479225 |
| Molecular Formula | C20H13BrN4O |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 2-[(2-bromophenyl)iminomethyl]-3-methyl-1-oxo-5H-pyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | Cc1c(/C=N/c2ccccc2Br)c(=O)n2c([nH]c3ccccc32)c1C#N |
| InChI | InChI=1S/C20H13BrN4O/c1-12-13(10-22)19-24-17-8-4-5-9-18(17)25(19)20(26)14(12)11-23-16-7-3-2-6-15(16)21/h2-9,11,24H,1H3/b23-11+ |
| InChIKey | MDUUJBVOGLIAGO-FOKLQQMPSA-N |
| XLogP | 4.47 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|